C13H17Br2NO2S — CID 61059668
2,4-dibromo-N-butyl-N-cyclopropylbenzenesulfonamide (PubChem CID 61059668) has the molecular formula C13H17Br2NO2S and a molecular weight of 411.16 g/mol. Its IUPAC name is 2,4-dibromo-N-butyl-N-cyclopropylbenzenesulfonamide.
| Compound Name | 2,4-dibromo-N-butyl-N-cyclopropylbenzenesulfonamide |
|---|---|
| PubChem CID | 61059668 |
| Molecular Formula | C13H17Br2NO2S |
| Molecular Weight | 411.16 g/mol |
| Exact Mass | 408.93 |
| IUPAC Name | 2,4-dibromo-N-butyl-N-cyclopropylbenzenesulfonamide |
| SMILES | CCCCN(C1CC1)S(=O)(=O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C13H17Br2NO2S/c1-2-3-8-16(11-5-6-11)19(17,18)13-7-4-10(14)9-12(13)15/h4,7,9,11H,2-3,5-6,8H2,1H3 |
| InChIKey | IQOLSJJJMIYLDS-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.16 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |