C22H28N2OS — CID 6105971
2-[(4-methylphenyl)methylsulfanyl]-N-[(E)-(4-methyl-4-phenylpentan-2-ylidene)amino]acetamide (PubChem CID 6105971) has the molecular formula C22H28N2OS and a molecular weight of 368.55 g/mol. Its IUPAC name is 2-[(4-methylphenyl)methylsulfanyl]-N-[(E)-(4-methyl-4-phenylpentan-2-ylidene)amino]acetamide.
| Compound Name | 2-[(4-methylphenyl)methylsulfanyl]-N-[(E)-(4-methyl-4-phenylpentan-2-ylidene)amino]acetamide |
|---|---|
| PubChem CID | 6105971 |
| Molecular Formula | C22H28N2OS |
| Molecular Weight | 368.55 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | 2-[(4-methylphenyl)methylsulfanyl]-N-[(E)-(4-methyl-4-phenylpentan-2-ylidene)amino]acetamide |
| SMILES | C/C(CC(C)(C)c1ccccc1)=N\NC(=O)CSCc1ccc(C)cc1 |
| InChI | InChI=1S/C22H28N2OS/c1-17-10-12-19(13-11-17)15-26-16-21(25)24-23-18(2)14-22(3,4)20-8-6-5-7-9-20/h5-13H,14-16H2,1-4H3,(H,24,25)/b23-18+ |
| InChIKey | AGLQHNZQUDAWTG-PTGBLXJZSA-N |
| XLogP | 5.09 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.55 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|