C17H20FNOS — CID 61060381
N-[(4-fluoro-3-thiophen-2-ylphenyl)methyl]-1-(oxolan-2-yl)ethanamine (PubChem CID 61060381) has the molecular formula C17H20FNOS and a molecular weight of 305.42 g/mol. Its IUPAC name is N-[(4-fluoro-3-thiophen-2-ylphenyl)methyl]-1-(oxolan-2-yl)ethanamine.
| Compound Name | N-[(4-fluoro-3-thiophen-2-ylphenyl)methyl]-1-(oxolan-2-yl)ethanamine |
|---|---|
| PubChem CID | 61060381 |
| Molecular Formula | C17H20FNOS |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | N-[(4-fluoro-3-thiophen-2-ylphenyl)methyl]-1-(oxolan-2-yl)ethanamine |
| SMILES | CC(NCc1ccc(F)c(-c2cccs2)c1)C1CCCO1 |
| InChI | InChI=1S/C17H20FNOS/c1-12(16-4-2-8-20-16)19-11-13-6-7-15(18)14(10-13)17-5-3-9-21-17/h3,5-7,9-10,12,16,19H,2,4,8,11H2,1H3 |
| InChIKey | MUTMICGRXSMOHV-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |