C14H20N2O4S — CID 61060489
3-cyano-N-(2-methoxyethyl)-N-(3-methoxypropyl)benzenesulfonamide (PubChem CID 61060489) has the molecular formula C14H20N2O4S and a molecular weight of 312.39 g/mol. Its IUPAC name is 3-cyano-N-(2-methoxyethyl)-N-(3-methoxypropyl)benzenesulfonamide.
| Compound Name | 3-cyano-N-(2-methoxyethyl)-N-(3-methoxypropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 61060489 |
| Molecular Formula | C14H20N2O4S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 3-cyano-N-(2-methoxyethyl)-N-(3-methoxypropyl)benzenesulfonamide |
| SMILES | COCCCN(CCOC)S(=O)(=O)c1cccc(C#N)c1 |
| InChI | InChI=1S/C14H20N2O4S/c1-19-9-4-7-16(8-10-20-2)21(17,18)14-6-3-5-13(11-14)12-15/h3,5-6,11H,4,7-10H2,1-2H3 |
| InChIKey | RNVLABKSZQSWOK-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|