C15H24N2O3S — CID 61066956
N-butan-2-yl-2-[(4-methylsulfonylphenyl)methylamino]propanamide (PubChem CID 61066956) has the molecular formula C15H24N2O3S and a molecular weight of 312.44 g/mol. Its IUPAC name is N-butan-2-yl-2-[(4-methylsulfonylphenyl)methylamino]propanamide.
| Compound Name | N-butan-2-yl-2-[(4-methylsulfonylphenyl)methylamino]propanamide |
|---|---|
| PubChem CID | 61066956 |
| Molecular Formula | C15H24N2O3S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | N-butan-2-yl-2-[(4-methylsulfonylphenyl)methylamino]propanamide |
| SMILES | CCC(C)NC(=O)C(C)NCc1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C15H24N2O3S/c1-5-11(2)17-15(18)12(3)16-10-13-6-8-14(9-7-13)21(4,19)20/h6-9,11-12,16H,5,10H2,1-4H3,(H,17,18) |
| InChIKey | INGZVSOFLWMGQR-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |