C11H20F3NO3 — CID 61068983
2,2,2-trifluoroethyl N-hexyl-N-(2-hydroxyethyl)carbamate (PubChem CID 61068983) has the molecular formula C11H20F3NO3 and a molecular weight of 271.28 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-hexyl-N-(2-hydroxyethyl)carbamate.
| Compound Name | 2,2,2-trifluoroethyl N-hexyl-N-(2-hydroxyethyl)carbamate |
|---|---|
| PubChem CID | 61068983 |
| Molecular Formula | C11H20F3NO3 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 2,2,2-trifluoroethyl N-hexyl-N-(2-hydroxyethyl)carbamate |
| SMILES | CCCCCCN(CCO)C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C11H20F3NO3/c1-2-3-4-5-6-15(7-8-16)10(17)18-9-11(12,13)14/h16H,2-9H2,1H3 |
| InChIKey | NIDFOHZNXAZRAD-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|