C12H18BrNO4S2 — CID 61069083
methyl 3-[(3-bromothiophen-2-yl)sulfonyl-(2-methylpropyl)amino]propanoate (PubChem CID 61069083) has the molecular formula C12H18BrNO4S2 and a molecular weight of 384.32 g/mol. Its IUPAC name is methyl 3-[(3-bromothiophen-2-yl)sulfonyl-(2-methylpropyl)amino]propanoate.
| Compound Name | methyl 3-[(3-bromothiophen-2-yl)sulfonyl-(2-methylpropyl)amino]propanoate |
|---|---|
| PubChem CID | 61069083 |
| Molecular Formula | C12H18BrNO4S2 |
| Molecular Weight | 384.32 g/mol |
| Exact Mass | 382.99 |
| IUPAC Name | methyl 3-[(3-bromothiophen-2-yl)sulfonyl-(2-methylpropyl)amino]propanoate |
| SMILES | COC(=O)CCN(CC(C)C)S(=O)(=O)c1sccc1Br |
| InChI | InChI=1S/C12H18BrNO4S2/c1-9(2)8-14(6-4-11(15)18-3)20(16,17)12-10(13)5-7-19-12/h5,7,9H,4,6,8H2,1-3H3 |
| InChIKey | RZRKERKRLNVLRX-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |