C14H18N2O4 — CID 61070063
3-butyl-5-[(3,4-dihydroxyphenyl)methyl]imidazolidine-2,4-dione (PubChem CID 61070063) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is 3-butyl-5-[(3,4-dihydroxyphenyl)methyl]imidazolidine-2,4-dione.
| Compound Name | 3-butyl-5-[(3,4-dihydroxyphenyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 61070063 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 3-butyl-5-[(3,4-dihydroxyphenyl)methyl]imidazolidine-2,4-dione |
| SMILES | CCCCN1C(=O)NC(Cc2ccc(O)c(O)c2)C1=O |
| InChI | InChI=1S/C14H18N2O4/c1-2-3-6-16-13(19)10(15-14(16)20)7-9-4-5-11(17)12(18)8-9/h4-5,8,10,17-18H,2-3,6-7H2,1H3,(H,15,20) |
| InChIKey | SWOTVGLZOSNYRJ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|