C17H22N4O6 — CID 102175916
2-(carbamoylamino)-6-[4-[(4-hydroxyphenyl)methyl]-2,5-dioxoimidazolidin-1-yl]hexanoic acid (PubChem CID 102175916) has the molecular formula C17H22N4O6 and a molecular weight of 378.39 g/mol. Its IUPAC name is 2-(carbamoylamino)-6-[4-[(4-hydroxyphenyl)methyl]-2,5-dioxoimidazolidin-1-yl]hexanoic acid.
| Compound Name | 2-(carbamoylamino)-6-[4-[(4-hydroxyphenyl)methyl]-2,5-dioxoimidazolidin-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 102175916 |
| Molecular Formula | C17H22N4O6 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 2-(carbamoylamino)-6-[4-[(4-hydroxyphenyl)methyl]-2,5-dioxoimidazolidin-1-yl]hexanoic acid |
| SMILES | NC(=O)NC(CCCCN1C(=O)NC(Cc2ccc(O)cc2)C1=O)C(=O)O |
| InChI | InChI=1S/C17H22N4O6/c18-16(26)19-12(15(24)25)3-1-2-8-21-14(23)13(20-17(21)27)9-10-4-6-11(22)7-5-10/h4-7,12-13,22H,1-3,8-9H2,(H,20,27)(H,24,25)(H3,18,19,26) |
| InChIKey | CCSZEZUDFLHJTA-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 162.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|