C10H15BrN2O3S2 — CID 61073569
2-[(3-bromothiophen-2-yl)sulfonyl-methylamino]-N-propylacetamide (PubChem CID 61073569) has the molecular formula C10H15BrN2O3S2 and a molecular weight of 355.28 g/mol. Its IUPAC name is 2-[(3-bromothiophen-2-yl)sulfonyl-methylamino]-N-propylacetamide.
| Compound Name | 2-[(3-bromothiophen-2-yl)sulfonyl-methylamino]-N-propylacetamide |
|---|---|
| PubChem CID | 61073569 |
| Molecular Formula | C10H15BrN2O3S2 |
| Molecular Weight | 355.28 g/mol |
| Exact Mass | 353.97 |
| IUPAC Name | 2-[(3-bromothiophen-2-yl)sulfonyl-methylamino]-N-propylacetamide |
| SMILES | CCCNC(=O)CN(C)S(=O)(=O)c1sccc1Br |
| InChI | InChI=1S/C10H15BrN2O3S2/c1-3-5-12-9(14)7-13(2)18(15,16)10-8(11)4-6-17-10/h4,6H,3,5,7H2,1-2H3,(H,12,14) |
| InChIKey | UEQUZHABAAOSKP-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.28 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |