C13H18N2OS — CID 61074576
5-(3-aminoprop-1-ynyl)-N-pentylthiophene-2-carboxamide (PubChem CID 61074576) has the molecular formula C13H18N2OS and a molecular weight of 250.37 g/mol. Its IUPAC name is 5-(3-aminoprop-1-ynyl)-N-pentylthiophene-2-carboxamide.
| Compound Name | 5-(3-aminoprop-1-ynyl)-N-pentylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 61074576 |
| Molecular Formula | C13H18N2OS |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 5-(3-aminoprop-1-ynyl)-N-pentylthiophene-2-carboxamide |
| SMILES | CCCCCNC(=O)c1ccc(C#CCN)s1 |
| InChI | InChI=1S/C13H18N2OS/c1-2-3-4-10-15-13(16)12-8-7-11(17-12)6-5-9-14/h7-8H,2-4,9-10,14H2,1H3,(H,15,16) |
| InChIKey | NRGYHPKEBIGAJS-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|