C10H13N3OS — CID 83023048
5-(3-aminoprop-1-ynyl)-N',N'-dimethylthiophene-2-carbohydrazide (PubChem CID 83023048) has the molecular formula C10H13N3OS and a molecular weight of 223.30 g/mol. Its IUPAC name is 5-(3-aminoprop-1-ynyl)-N',N'-dimethylthiophene-2-carbohydrazide.
| Compound Name | 5-(3-aminoprop-1-ynyl)-N',N'-dimethylthiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 83023048 |
| Molecular Formula | C10H13N3OS |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 5-(3-aminoprop-1-ynyl)-N',N'-dimethylthiophene-2-carbohydrazide |
| SMILES | CN(C)NC(=O)c1ccc(C#CCN)s1 |
| InChI | InChI=1S/C10H13N3OS/c1-13(2)12-10(14)9-6-5-8(15-9)4-3-7-11/h5-6H,7,11H2,1-2H3,(H,12,14) |
| InChIKey | PWMWHZXJIPMQKD-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|