C15H14F3NO — CID 61074846
2,3-difluoro-N-[1-(2-fluoro-4-methoxyphenyl)ethyl]aniline (PubChem CID 61074846) has the molecular formula C15H14F3NO and a molecular weight of 281.28 g/mol. Its IUPAC name is 2,3-difluoro-N-[1-(2-fluoro-4-methoxyphenyl)ethyl]aniline.
| Compound Name | 2,3-difluoro-N-[1-(2-fluoro-4-methoxyphenyl)ethyl]aniline |
|---|---|
| PubChem CID | 61074846 |
| Molecular Formula | C15H14F3NO |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 2,3-difluoro-N-[1-(2-fluoro-4-methoxyphenyl)ethyl]aniline |
| SMILES | COc1ccc(C(C)Nc2cccc(F)c2F)c(F)c1 |
| InChI | InChI=1S/C15H14F3NO/c1-9(11-7-6-10(20-2)8-13(11)17)19-14-5-3-4-12(16)15(14)18/h3-9,19H,1-2H3 |
| InChIKey | FBQJVCBPRWAELG-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |