C17H16N2OS — CID 61075652
[5-(3-aminoprop-1-ynyl)thiophen-2-yl]-(3,4-dihydro-1H-isoquinolin-2-yl)methanone (PubChem CID 61075652) has the molecular formula C17H16N2OS and a molecular weight of 296.40 g/mol. Its IUPAC name is [5-(3-aminoprop-1-ynyl)thiophen-2-yl]-(3,4-dihydro-1H-isoquinolin-2-yl)methanone.
| Compound Name | [5-(3-aminoprop-1-ynyl)thiophen-2-yl]-(3,4-dihydro-1H-isoquinolin-2-yl)methanone |
|---|---|
| PubChem CID | 61075652 |
| Molecular Formula | C17H16N2OS |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | [5-(3-aminoprop-1-ynyl)thiophen-2-yl]-(3,4-dihydro-1H-isoquinolin-2-yl)methanone |
| SMILES | NCC#Cc1ccc(C(=O)N2CCc3ccccc3C2)s1 |
| InChI | InChI=1S/C17H16N2OS/c18-10-3-6-15-7-8-16(21-15)17(20)19-11-9-13-4-1-2-5-14(13)12-19/h1-2,4-5,7-8H,9-12,18H2 |
| InChIKey | YPVLPZUQODDMLJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|