C15H17NS — CID 61078821
1-(2,3-dihydro-1H-inden-5-yl)-2-thiophen-3-ylethanamine (PubChem CID 61078821) has the molecular formula C15H17NS and a molecular weight of 243.38 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-yl)-2-thiophen-3-ylethanamine.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-thiophen-3-ylethanamine |
|---|---|
| PubChem CID | 61078821 |
| Molecular Formula | C15H17NS |
| Molecular Weight | 243.38 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-thiophen-3-ylethanamine |
| SMILES | NC(Cc1ccsc1)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C15H17NS/c16-15(8-11-6-7-17-10-11)14-5-4-12-2-1-3-13(12)9-14/h4-7,9-10,15H,1-3,8,16H2 |
| InChIKey | BFWRYWVCKZWSAS-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.38 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |