C14H12Cl2O3S — CID 61082000
(2,5-dichlorophenyl)-(3-methylsulfonylphenyl)methanol (PubChem CID 61082000) has the molecular formula C14H12Cl2O3S and a molecular weight of 331.22 g/mol. Its IUPAC name is (2,5-dichlorophenyl)-(3-methylsulfonylphenyl)methanol.
| Compound Name | (2,5-dichlorophenyl)-(3-methylsulfonylphenyl)methanol |
|---|---|
| PubChem CID | 61082000 |
| Molecular Formula | C14H12Cl2O3S |
| Molecular Weight | 331.22 g/mol |
| Exact Mass | 329.99 |
| IUPAC Name | (2,5-dichlorophenyl)-(3-methylsulfonylphenyl)methanol |
| SMILES | CS(=O)(=O)c1cccc(C(O)c2cc(Cl)ccc2Cl)c1 |
| InChI | InChI=1S/C14H12Cl2O3S/c1-20(18,19)11-4-2-3-9(7-11)14(17)12-8-10(15)5-6-13(12)16/h2-8,14,17H,1H3 |
| InChIKey | SHUVGQOFWOJCOO-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.22 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |