C18H20Cl2O3S — CID 158181302
(1S,2R)-2-(3,4-dichlorophenyl)-1-(3-methylsulfonylphenyl)pentan-1-ol (PubChem CID 158181302) has the molecular formula C18H20Cl2O3S and a molecular weight of 387.33 g/mol. Its IUPAC name is (1S,2R)-2-(3,4-dichlorophenyl)-1-(3-methylsulfonylphenyl)pentan-1-ol.
| Compound Name | (1S,2R)-2-(3,4-dichlorophenyl)-1-(3-methylsulfonylphenyl)pentan-1-ol |
|---|---|
| PubChem CID | 158181302 |
| Molecular Formula | C18H20Cl2O3S |
| Molecular Weight | 387.33 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | (1S,2R)-2-(3,4-dichlorophenyl)-1-(3-methylsulfonylphenyl)pentan-1-ol |
| SMILES | CCC[C@H](c1ccc(Cl)c(Cl)c1)[C@H](O)c1cccc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C18H20Cl2O3S/c1-3-5-15(12-8-9-16(19)17(20)11-12)18(21)13-6-4-7-14(10-13)24(2,22)23/h4,6-11,15,18,21H,3,5H2,1-2H3/t15-,18-/m1/s1 |
| InChIKey | FYPYVMRAEPWYJO-CRAIPNDOSA-N |
| XLogP | 5.01 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.33 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |