C18H20Cl2OS — CID 146772991
(1R,2S)-2-(3,4-dichlorophenyl)-1-(3-methylsulfanylphenyl)pentan-1-ol (PubChem CID 146772991) has the molecular formula C18H20Cl2OS and a molecular weight of 355.33 g/mol. Its IUPAC name is (1R,2S)-2-(3,4-dichlorophenyl)-1-(3-methylsulfanylphenyl)pentan-1-ol.
| Compound Name | (1R,2S)-2-(3,4-dichlorophenyl)-1-(3-methylsulfanylphenyl)pentan-1-ol |
|---|---|
| PubChem CID | 146772991 |
| Molecular Formula | C18H20Cl2OS |
| Molecular Weight | 355.33 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | (1R,2S)-2-(3,4-dichlorophenyl)-1-(3-methylsulfanylphenyl)pentan-1-ol |
| SMILES | CCC[C@@H](c1ccc(Cl)c(Cl)c1)[C@@H](O)c1cccc(SC)c1 |
| InChI | InChI=1S/C18H20Cl2OS/c1-3-5-15(12-8-9-16(19)17(20)11-12)18(21)13-6-4-7-14(10-13)22-2/h4,6-11,15,18,21H,3,5H2,1-2H3/t15-,18-/m0/s1 |
| InChIKey | RSBYINBBLATIGY-YJBOKZPZSA-N |
| XLogP | 6.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.33 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |