C15H12ClFN2O — CID 61085159
5-[1-chloro-2-(3-fluorophenyl)ethyl]-1,3-dihydrobenzimidazol-2-one (PubChem CID 61085159) has the molecular formula C15H12ClFN2O and a molecular weight of 290.73 g/mol. Its IUPAC name is 5-[1-chloro-2-(3-fluorophenyl)ethyl]-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-[1-chloro-2-(3-fluorophenyl)ethyl]-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 61085159 |
| Molecular Formula | C15H12ClFN2O |
| Molecular Weight | 290.73 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 5-[1-chloro-2-(3-fluorophenyl)ethyl]-1,3-dihydrobenzimidazol-2-one |
| SMILES | O=c1[nH]c2ccc(C(Cl)Cc3cccc(F)c3)cc2[nH]1 |
| InChI | InChI=1S/C15H12ClFN2O/c16-12(7-9-2-1-3-11(17)6-9)10-4-5-13-14(8-10)19-15(20)18-13/h1-6,8,12H,7H2,(H2,18,19,20) |
| InChIKey | AUESAJIUJOVXIR-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.73 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|