C14H10BrFN2O — CID 61096909
5-[bromo-(3-fluorophenyl)methyl]-1,3-dihydrobenzimidazol-2-one (PubChem CID 61096909) has the molecular formula C14H10BrFN2O and a molecular weight of 321.15 g/mol. Its IUPAC name is 5-[bromo-(3-fluorophenyl)methyl]-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-[bromo-(3-fluorophenyl)methyl]-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 61096909 |
| Molecular Formula | C14H10BrFN2O |
| Molecular Weight | 321.15 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | 5-[bromo-(3-fluorophenyl)methyl]-1,3-dihydrobenzimidazol-2-one |
| SMILES | O=c1[nH]c2ccc(C(Br)c3cccc(F)c3)cc2[nH]1 |
| InChI | InChI=1S/C14H10BrFN2O/c15-13(8-2-1-3-10(16)6-8)9-4-5-11-12(7-9)18-14(19)17-11/h1-7,13H,(H2,17,18,19) |
| InChIKey | RGYJYMGRVIIQOR-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.15 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|