C11H7BrF6N2O — CID 103310702
5-[1-bromo-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-1,3-dihydrobenzimidazol-2-one (PubChem CID 103310702) has the molecular formula C11H7BrF6N2O and a molecular weight of 377.08 g/mol. Its IUPAC name is 5-[1-bromo-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-[1-bromo-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 103310702 |
| Molecular Formula | C11H7BrF6N2O |
| Molecular Weight | 377.08 g/mol |
| Exact Mass | 375.96 |
| IUPAC Name | 5-[1-bromo-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-1,3-dihydrobenzimidazol-2-one |
| SMILES | O=c1[nH]c2ccc(C(Br)C(C(F)(F)F)C(F)(F)F)cc2[nH]1 |
| InChI | InChI=1S/C11H7BrF6N2O/c12-7(8(10(13,14)15)11(16,17)18)4-1-2-5-6(3-4)20-9(21)19-5/h1-3,7-8H,(H2,19,20,21) |
| InChIKey | KAUWNBSPEGHAQR-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.08 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|