C12H12BrF3N2O2 — CID 103210875
5-[1-bromo-3-(2,2,2-trifluoroethoxy)propyl]-1,3-dihydrobenzimidazol-2-one (PubChem CID 103210875) has the molecular formula C12H12BrF3N2O2 and a molecular weight of 353.14 g/mol. Its IUPAC name is 5-[1-bromo-3-(2,2,2-trifluoroethoxy)propyl]-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-[1-bromo-3-(2,2,2-trifluoroethoxy)propyl]-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 103210875 |
| Molecular Formula | C12H12BrF3N2O2 |
| Molecular Weight | 353.14 g/mol |
| Exact Mass | 352.00 |
| IUPAC Name | 5-[1-bromo-3-(2,2,2-trifluoroethoxy)propyl]-1,3-dihydrobenzimidazol-2-one |
| SMILES | O=c1[nH]c2ccc(C(Br)CCOCC(F)(F)F)cc2[nH]1 |
| InChI | InChI=1S/C12H12BrF3N2O2/c13-8(3-4-20-6-12(14,15)16)7-1-2-9-10(5-7)18-11(19)17-9/h1-2,5,8H,3-4,6H2,(H2,17,18,19) |
| InChIKey | HSOOFMXANRIZQN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 57.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.14 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|