C14H19F2N3O2 — CID 103207310
5-[3-(2,2-difluoroethoxy)-1-(ethylamino)propyl]-1,3-dihydrobenzimidazol-2-one (PubChem CID 103207310) has the molecular formula C14H19F2N3O2 and a molecular weight of 299.32 g/mol. Its IUPAC name is 5-[3-(2,2-difluoroethoxy)-1-(ethylamino)propyl]-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-[3-(2,2-difluoroethoxy)-1-(ethylamino)propyl]-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 103207310 |
| Molecular Formula | C14H19F2N3O2 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 5-[3-(2,2-difluoroethoxy)-1-(ethylamino)propyl]-1,3-dihydrobenzimidazol-2-one |
| SMILES | CCNC(CCOCC(F)F)c1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C14H19F2N3O2/c1-2-17-10(5-6-21-8-13(15)16)9-3-4-11-12(7-9)19-14(20)18-11/h3-4,7,10,13,17H,2,5-6,8H2,1H3,(H2,18,19,20) |
| InChIKey | YCQNXYMMCRRXDY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 69.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|