C17H12F2O — CID 61087726
(2,4-difluorophenyl)-naphthalen-1-ylmethanol (PubChem CID 61087726) has the molecular formula C17H12F2O and a molecular weight of 270.28 g/mol. Its IUPAC name is (2,4-difluorophenyl)-naphthalen-1-ylmethanol.
| Compound Name | (2,4-difluorophenyl)-naphthalen-1-ylmethanol |
|---|---|
| PubChem CID | 61087726 |
| Molecular Formula | C17H12F2O |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | (2,4-difluorophenyl)-naphthalen-1-ylmethanol |
| SMILES | OC(c1ccc(F)cc1F)c1cccc2ccccc12 |
| InChI | InChI=1S/C17H12F2O/c18-12-8-9-15(16(19)10-12)17(20)14-7-3-5-11-4-1-2-6-13(11)14/h1-10,17,20H |
| InChIKey | SELVOIIKUQESST-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |