C11H10N2O3S — CID 6109654
(3Z)-1-acetyl-3-(thiophen-2-ylmethylidene)piperazine-2,5-dione (PubChem CID 6109654) has the molecular formula C11H10N2O3S and a molecular weight of 250.28 g/mol. Its IUPAC name is (3Z)-1-acetyl-3-(thiophen-2-ylmethylidene)piperazine-2,5-dione.
| Compound Name | (3Z)-1-acetyl-3-(thiophen-2-ylmethylidene)piperazine-2,5-dione |
|---|---|
| PubChem CID | 6109654 |
| Molecular Formula | C11H10N2O3S |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | (3Z)-1-acetyl-3-(thiophen-2-ylmethylidene)piperazine-2,5-dione |
| SMILES | CC(=O)N1CC(=O)N/C(=C\c2cccs2)C1=O |
| InChI | InChI=1S/C11H10N2O3S/c1-7(14)13-6-10(15)12-9(11(13)16)5-8-3-2-4-17-8/h2-5H,6H2,1H3,(H,12,15)/b9-5- |
| InChIKey | OTFAGYBUTGLAFS-UITAMQMPSA-N |
| XLogP | 0.59 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|