C15H10BrClFNO2 — CID 61096968
6-[bromo-(4-chloro-2-fluorophenyl)methyl]-4H-1,4-benzoxazin-3-one (PubChem CID 61096968) has the molecular formula C15H10BrClFNO2 and a molecular weight of 370.61 g/mol. Its IUPAC name is 6-[bromo-(4-chloro-2-fluorophenyl)methyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[bromo-(4-chloro-2-fluorophenyl)methyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 61096968 |
| Molecular Formula | C15H10BrClFNO2 |
| Molecular Weight | 370.61 g/mol |
| Exact Mass | 368.96 |
| IUPAC Name | 6-[bromo-(4-chloro-2-fluorophenyl)methyl]-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(C(Br)c3ccc(Cl)cc3F)cc2N1 |
| InChI | InChI=1S/C15H10BrClFNO2/c16-15(10-3-2-9(17)6-11(10)18)8-1-4-13-12(5-8)19-14(20)7-21-13/h1-6,15H,7H2,(H,19,20) |
| InChIKey | ZCPWFOARUOKOTJ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.61 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|