C14H17F3N2O — CID 61102860
2-[2-(diethylamino)ethoxy]-5-(trifluoromethyl)benzonitrile (PubChem CID 61102860) has the molecular formula C14H17F3N2O and a molecular weight of 286.30 g/mol. Its IUPAC name is 2-[2-(diethylamino)ethoxy]-5-(trifluoromethyl)benzonitrile.
| Compound Name | 2-[2-(diethylamino)ethoxy]-5-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 61102860 |
| Molecular Formula | C14H17F3N2O |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 2-[2-(diethylamino)ethoxy]-5-(trifluoromethyl)benzonitrile |
| SMILES | CCN(CC)CCOc1ccc(C(F)(F)F)cc1C#N |
| InChI | InChI=1S/C14H17F3N2O/c1-3-19(4-2)7-8-20-13-6-5-12(14(15,16)17)9-11(13)10-18/h5-6,9H,3-4,7-8H2,1-2H3 |
| InChIKey | LNAGWMXVTLKAIJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |