C14H24N4O2 — CID 61106654
4-amino-N-ethyl-N-[2-(ethylamino)-2-oxoethyl]-1-propan-2-ylpyrrole-2-carboxamide (PubChem CID 61106654) has the molecular formula C14H24N4O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is 4-amino-N-ethyl-N-[2-(ethylamino)-2-oxoethyl]-1-propan-2-ylpyrrole-2-carboxamide.
| Compound Name | 4-amino-N-ethyl-N-[2-(ethylamino)-2-oxoethyl]-1-propan-2-ylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 61106654 |
| Molecular Formula | C14H24N4O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 4-amino-N-ethyl-N-[2-(ethylamino)-2-oxoethyl]-1-propan-2-ylpyrrole-2-carboxamide |
| SMILES | CCNC(=O)CN(CC)C(=O)c1cc(N)cn1C(C)C |
| InChI | InChI=1S/C14H24N4O2/c1-5-16-13(19)9-17(6-2)14(20)12-7-11(15)8-18(12)10(3)4/h7-8,10H,5-6,9,15H2,1-4H3,(H,16,19) |
| InChIKey | PDDSIKQNGQYVJL-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 80.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |