C12H17Br2N3O3S — CID 61116167
2-[(4-amino-2,6-dibromophenyl)sulfonyl-(2-methylpropyl)amino]acetamide (PubChem CID 61116167) has the molecular formula C12H17Br2N3O3S and a molecular weight of 443.16 g/mol. Its IUPAC name is 2-[(4-amino-2,6-dibromophenyl)sulfonyl-(2-methylpropyl)amino]acetamide.
| Compound Name | 2-[(4-amino-2,6-dibromophenyl)sulfonyl-(2-methylpropyl)amino]acetamide |
|---|---|
| PubChem CID | 61116167 |
| Molecular Formula | C12H17Br2N3O3S |
| Molecular Weight | 443.16 g/mol |
| Exact Mass | 440.94 |
| IUPAC Name | 2-[(4-amino-2,6-dibromophenyl)sulfonyl-(2-methylpropyl)amino]acetamide |
| SMILES | CC(C)CN(CC(N)=O)S(=O)(=O)c1c(Br)cc(N)cc1Br |
| InChI | InChI=1S/C12H17Br2N3O3S/c1-7(2)5-17(6-11(16)18)21(19,20)12-9(13)3-8(15)4-10(12)14/h3-4,7H,5-6,15H2,1-2H3,(H2,16,18) |
| InChIKey | CHROFFSEFYIDHL-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.16 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|