C13H16BrFN2OS — CID 61120812
2-bromo-N-(3-carbamothioylpentan-3-yl)-4-fluorobenzamide (PubChem CID 61120812) has the molecular formula C13H16BrFN2OS and a molecular weight of 347.25 g/mol. Its IUPAC name is 2-bromo-N-(3-carbamothioylpentan-3-yl)-4-fluorobenzamide.
| Compound Name | 2-bromo-N-(3-carbamothioylpentan-3-yl)-4-fluorobenzamide |
|---|---|
| PubChem CID | 61120812 |
| Molecular Formula | C13H16BrFN2OS |
| Molecular Weight | 347.25 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | 2-bromo-N-(3-carbamothioylpentan-3-yl)-4-fluorobenzamide |
| SMILES | CCC(CC)(NC(=O)c1ccc(F)cc1Br)C(N)=S |
| InChI | InChI=1S/C13H16BrFN2OS/c1-3-13(4-2,12(16)19)17-11(18)9-6-5-8(15)7-10(9)14/h5-7H,3-4H2,1-2H3,(H2,16,19)(H,17,18) |
| InChIKey | HVILULPRHBYEJW-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.25 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|