C8H15F2N3O2S2 — CID 61121991
4-(difluoromethylsulfonylamino)-1-methylpiperidine-4-carbothioamide (PubChem CID 61121991) has the molecular formula C8H15F2N3O2S2 and a molecular weight of 287.36 g/mol. Its IUPAC name is 4-(difluoromethylsulfonylamino)-1-methylpiperidine-4-carbothioamide.
| Compound Name | 4-(difluoromethylsulfonylamino)-1-methylpiperidine-4-carbothioamide |
|---|---|
| PubChem CID | 61121991 |
| Molecular Formula | C8H15F2N3O2S2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 4-(difluoromethylsulfonylamino)-1-methylpiperidine-4-carbothioamide |
| SMILES | CN1CCC(NS(=O)(=O)C(F)F)(C(N)=S)CC1 |
| InChI | InChI=1S/C8H15F2N3O2S2/c1-13-4-2-8(3-5-13,6(11)16)12-17(14,15)7(9)10/h7,12H,2-5H2,1H3,(H2,11,16) |
| InChIKey | CAMBREBEFOZOSH-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|