C15H27N3O2S — CID 61122297
N-(1-cyano-4-ethylcyclohexyl)-3-methylpiperidine-1-sulfonamide (PubChem CID 61122297) has the molecular formula C15H27N3O2S and a molecular weight of 313.47 g/mol. Its IUPAC name is N-(1-cyano-4-ethylcyclohexyl)-3-methylpiperidine-1-sulfonamide.
| Compound Name | N-(1-cyano-4-ethylcyclohexyl)-3-methylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 61122297 |
| Molecular Formula | C15H27N3O2S |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | N-(1-cyano-4-ethylcyclohexyl)-3-methylpiperidine-1-sulfonamide |
| SMILES | CCC1CCC(C#N)(NS(=O)(=O)N2CCCC(C)C2)CC1 |
| InChI | InChI=1S/C15H27N3O2S/c1-3-14-6-8-15(12-16,9-7-14)17-21(19,20)18-10-4-5-13(2)11-18/h13-14,17H,3-11H2,1-2H3 |
| InChIKey | QITWRSGNIUMOBA-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |