C15H31N3O2S — CID 43119837
N-[1-(aminomethyl)-4-ethylcyclohexyl]-2-methylpiperidine-1-sulfonamide (PubChem CID 43119837) has the molecular formula C15H31N3O2S and a molecular weight of 317.50 g/mol. Its IUPAC name is N-[1-(aminomethyl)-4-ethylcyclohexyl]-2-methylpiperidine-1-sulfonamide.
| Compound Name | N-[1-(aminomethyl)-4-ethylcyclohexyl]-2-methylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 43119837 |
| Molecular Formula | C15H31N3O2S |
| Molecular Weight | 317.50 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | N-[1-(aminomethyl)-4-ethylcyclohexyl]-2-methylpiperidine-1-sulfonamide |
| SMILES | CCC1CCC(CN)(NS(=O)(=O)N2CCCCC2C)CC1 |
| InChI | InChI=1S/C15H31N3O2S/c1-3-14-7-9-15(12-16,10-8-14)17-21(19,20)18-11-5-4-6-13(18)2/h13-14,17H,3-12,16H2,1-2H3 |
| InChIKey | GAXXOVFJPCBOFD-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.50 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |