C13H25N3O2S2 — CID 61122475
4-ethyl-1-(pyrrolidin-1-ylsulfonylamino)cyclohexane-1-carbothioamide (PubChem CID 61122475) has the molecular formula C13H25N3O2S2 and a molecular weight of 319.50 g/mol. Its IUPAC name is 4-ethyl-1-(pyrrolidin-1-ylsulfonylamino)cyclohexane-1-carbothioamide.
| Compound Name | 4-ethyl-1-(pyrrolidin-1-ylsulfonylamino)cyclohexane-1-carbothioamide |
|---|---|
| PubChem CID | 61122475 |
| Molecular Formula | C13H25N3O2S2 |
| Molecular Weight | 319.50 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 4-ethyl-1-(pyrrolidin-1-ylsulfonylamino)cyclohexane-1-carbothioamide |
| SMILES | CCC1CCC(NS(=O)(=O)N2CCCC2)(C(N)=S)CC1 |
| InChI | InChI=1S/C13H25N3O2S2/c1-2-11-5-7-13(8-6-11,12(14)19)15-20(17,18)16-9-3-4-10-16/h11,15H,2-10H2,1H3,(H2,14,19) |
| InChIKey | AEZUUUSVXZJSSJ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.50 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|