C12H22N2O2S2 — CID 61122925
1-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-ethylcyclohexane-1-carbothioamide (PubChem CID 61122925) has the molecular formula C12H22N2O2S2 and a molecular weight of 290.45 g/mol. Its IUPAC name is 1-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-ethylcyclohexane-1-carbothioamide.
| Compound Name | 1-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-ethylcyclohexane-1-carbothioamide |
|---|---|
| PubChem CID | 61122925 |
| Molecular Formula | C12H22N2O2S2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 1-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-ethylcyclohexane-1-carbothioamide |
| SMILES | CCC1CCC(C(N)=S)(N2CCCS2(=O)=O)CC1 |
| InChI | InChI=1S/C12H22N2O2S2/c1-2-10-4-6-12(7-5-10,11(13)17)14-8-3-9-18(14,15)16/h10H,2-9H2,1H3,(H2,13,17) |
| InChIKey | WZTLROLWAOJBLD-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|