C11H20N2O2S2 — CID 61123133
1-(1,1-dioxo-1,2-thiazolidin-2-yl)cycloheptane-1-carbothioamide (PubChem CID 61123133) has the molecular formula C11H20N2O2S2 and a molecular weight of 276.43 g/mol. Its IUPAC name is 1-(1,1-dioxo-1,2-thiazolidin-2-yl)cycloheptane-1-carbothioamide.
| Compound Name | 1-(1,1-dioxo-1,2-thiazolidin-2-yl)cycloheptane-1-carbothioamide |
|---|---|
| PubChem CID | 61123133 |
| Molecular Formula | C11H20N2O2S2 |
| Molecular Weight | 276.43 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 1-(1,1-dioxo-1,2-thiazolidin-2-yl)cycloheptane-1-carbothioamide |
| SMILES | NC(=S)C1(N2CCCS2(=O)=O)CCCCCC1 |
| InChI | InChI=1S/C11H20N2O2S2/c12-10(16)11(6-3-1-2-4-7-11)13-8-5-9-17(13,14)15/h1-9H2,(H2,12,16) |
| InChIKey | SSSYRXNBJMHJHW-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.43 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|