C10H18N2O2S2 — CID 61122923
1-(1,1-dioxo-1,2-thiazolidin-2-yl)cyclohexane-1-carbothioamide (PubChem CID 61122923) has the molecular formula C10H18N2O2S2 and a molecular weight of 262.40 g/mol. Its IUPAC name is 1-(1,1-dioxo-1,2-thiazolidin-2-yl)cyclohexane-1-carbothioamide.
| Compound Name | 1-(1,1-dioxo-1,2-thiazolidin-2-yl)cyclohexane-1-carbothioamide |
|---|---|
| PubChem CID | 61122923 |
| Molecular Formula | C10H18N2O2S2 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 1-(1,1-dioxo-1,2-thiazolidin-2-yl)cyclohexane-1-carbothioamide |
| SMILES | NC(=S)C1(N2CCCS2(=O)=O)CCCCC1 |
| InChI | InChI=1S/C10H18N2O2S2/c11-9(15)10(5-2-1-3-6-10)12-7-4-8-16(12,13)14/h1-8H2,(H2,11,15) |
| InChIKey | NURZVKOPSDVXPP-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|