C10H19N3O2S2 — CID 61123774
4-(1,1-dioxo-1,2-thiazolidin-2-yl)-1-methylpiperidine-4-carbothioamide (PubChem CID 61123774) has the molecular formula C10H19N3O2S2 and a molecular weight of 277.41 g/mol. Its IUPAC name is 4-(1,1-dioxo-1,2-thiazolidin-2-yl)-1-methylpiperidine-4-carbothioamide.
| Compound Name | 4-(1,1-dioxo-1,2-thiazolidin-2-yl)-1-methylpiperidine-4-carbothioamide |
|---|---|
| PubChem CID | 61123774 |
| Molecular Formula | C10H19N3O2S2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 4-(1,1-dioxo-1,2-thiazolidin-2-yl)-1-methylpiperidine-4-carbothioamide |
| SMILES | CN1CCC(C(N)=S)(N2CCCS2(=O)=O)CC1 |
| InChI | InChI=1S/C10H19N3O2S2/c1-12-6-3-10(4-7-12,9(11)16)13-5-2-8-17(13,14)15/h2-8H2,1H3,(H2,11,16) |
| InChIKey | HZGXTYFAZXHEEW-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|