C9H18N2O2S2 — CID 61123325
2-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-ethylbutanethioamide (PubChem CID 61123325) has the molecular formula C9H18N2O2S2 and a molecular weight of 250.39 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-ethylbutanethioamide.
| Compound Name | 2-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-ethylbutanethioamide |
|---|---|
| PubChem CID | 61123325 |
| Molecular Formula | C9H18N2O2S2 |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 2-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-ethylbutanethioamide |
| SMILES | CCC(CC)(C(N)=S)N1CCCS1(=O)=O |
| InChI | InChI=1S/C9H18N2O2S2/c1-3-9(4-2,8(10)14)11-6-5-7-15(11,12)13/h3-7H2,1-2H3,(H2,10,14) |
| InChIKey | AKDGZGLTMVUHJC-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|