C7H14N2O2S2 — CID 61121035
2-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-methylpropanethioamide (PubChem CID 61121035) has the molecular formula C7H14N2O2S2 and a molecular weight of 222.33 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-methylpropanethioamide.
| Compound Name | 2-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-methylpropanethioamide |
|---|---|
| PubChem CID | 61121035 |
| Molecular Formula | C7H14N2O2S2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | 2-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-methylpropanethioamide |
| SMILES | CC(C)(C(N)=S)N1CCCS1(=O)=O |
| InChI | InChI=1S/C7H14N2O2S2/c1-7(2,6(8)12)9-4-3-5-13(9,10)11/h3-5H2,1-2H3,(H2,8,12) |
| InChIKey | GJGXLZZTALNMEY-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|