C9H21N3O2S2 — CID 61122681
2-(diethylsulfamoylamino)-2-methylbutanethioamide (PubChem CID 61122681) has the molecular formula C9H21N3O2S2 and a molecular weight of 267.42 g/mol. Its IUPAC name is 2-(diethylsulfamoylamino)-2-methylbutanethioamide.
| Compound Name | 2-(diethylsulfamoylamino)-2-methylbutanethioamide |
|---|---|
| PubChem CID | 61122681 |
| Molecular Formula | C9H21N3O2S2 |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 2-(diethylsulfamoylamino)-2-methylbutanethioamide |
| SMILES | CCN(CC)S(=O)(=O)NC(C)(CC)C(N)=S |
| InChI | InChI=1S/C9H21N3O2S2/c1-5-9(4,8(10)15)11-16(13,14)12(6-2)7-3/h11H,5-7H2,1-4H3,(H2,10,15) |
| InChIKey | QJQKEHAXHWNRDL-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|