C10H23N3O2S2 — CID 61124290
2-(diethylsulfamoylamino)-2-ethylbutanethioamide (PubChem CID 61124290) has the molecular formula C10H23N3O2S2 and a molecular weight of 281.45 g/mol. Its IUPAC name is 2-(diethylsulfamoylamino)-2-ethylbutanethioamide.
| Compound Name | 2-(diethylsulfamoylamino)-2-ethylbutanethioamide |
|---|---|
| PubChem CID | 61124290 |
| Molecular Formula | C10H23N3O2S2 |
| Molecular Weight | 281.45 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 2-(diethylsulfamoylamino)-2-ethylbutanethioamide |
| SMILES | CCN(CC)S(=O)(=O)NC(CC)(CC)C(N)=S |
| InChI | InChI=1S/C10H23N3O2S2/c1-5-10(6-2,9(11)16)12-17(14,15)13(7-3)8-4/h12H,5-8H2,1-4H3,(H2,11,16) |
| InChIKey | LVABPMSGNJHQKG-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.45 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|