C28H29N3O4S — CID 6112336
(E)-N-butan-2-yl-3-(4-nitrophenyl)-N-[2-oxo-2-(4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]prop-2-enamide (PubChem CID 6112336) has the molecular formula C28H29N3O4S and a molecular weight of 503.62 g/mol. Its IUPAC name is (E)-N-butan-2-yl-3-(4-nitrophenyl)-N-[2-oxo-2-(4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]prop-2-enamide.
| Compound Name | (E)-N-butan-2-yl-3-(4-nitrophenyl)-N-[2-oxo-2-(4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 6112336 |
| Molecular Formula | C28H29N3O4S |
| Molecular Weight | 503.62 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | (E)-N-butan-2-yl-3-(4-nitrophenyl)-N-[2-oxo-2-(4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]prop-2-enamide |
| SMILES | CCC(C)N(CC(=O)N1CCc2sccc2C1c1ccccc1)C(=O)/C=C/c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H29N3O4S/c1-3-20(2)30(26(32)14-11-21-9-12-23(13-10-21)31(34)35)19-27(33)29-17-15-25-24(16-18-36-25)28(29)22-7-5-4-6-8-22/h4-14,16,18,20,28H,3,15,17,19H2,1-2H3/b14-11+ |
| InChIKey | XKLRITCKXNSQJP-SDNWHVSQSA-N |
| XLogP | 5.47 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.62 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|