C28H27N3O5S — CID 92516185
(E)-N-[2-[(4S)-4-(4-methoxyphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]-3-(4-nitrophenyl)-N-prop-2-enylprop-2-enamide (PubChem CID 92516185) has the molecular formula C28H27N3O5S and a molecular weight of 517.61 g/mol. Its IUPAC name is (E)-N-[2-[(4S)-4-(4-methoxyphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]-3-(4-nitrophenyl)-N-prop-2-enylprop-2-enamide.
| Compound Name | (E)-N-[2-[(4S)-4-(4-methoxyphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]-3-(4-nitrophenyl)-N-prop-2-enylprop-2-enamide |
|---|---|
| PubChem CID | 92516185 |
| Molecular Formula | C28H27N3O5S |
| Molecular Weight | 517.61 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | (E)-N-[2-[(4S)-4-(4-methoxyphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]-3-(4-nitrophenyl)-N-prop-2-enylprop-2-enamide |
| SMILES | C=CCN(CC(=O)N1CCc2sccc2[C@@H]1c1ccc(OC)cc1)C(=O)/C=C/c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H27N3O5S/c1-3-16-29(26(32)13-6-20-4-9-22(10-5-20)31(34)35)19-27(33)30-17-14-25-24(15-18-37-25)28(30)21-7-11-23(36-2)12-8-21/h3-13,15,18,28H,1,14,16-17,19H2,2H3/b13-6+/t28-/m0/s1 |
| InChIKey | SZOYCGBKDUOOEQ-QGNAOPSZSA-N |
| XLogP | 4.87 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.61 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|