C25H22FN3O4S — CID 5024622
N-[2-[4-(4-fluorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]-4-nitro-N-prop-2-enylbenzamide (PubChem CID 5024622) has the molecular formula C25H22FN3O4S and a molecular weight of 479.53 g/mol. Its IUPAC name is N-[2-[4-(4-fluorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]-4-nitro-N-prop-2-enylbenzamide.
| Compound Name | N-[2-[4-(4-fluorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]-4-nitro-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 5024622 |
| Molecular Formula | C25H22FN3O4S |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | N-[2-[4-(4-fluorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]-4-nitro-N-prop-2-enylbenzamide |
| SMILES | C=CCN(CC(=O)N1CCc2sccc2C1c1ccc(F)cc1)C(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H22FN3O4S/c1-2-13-27(25(31)18-5-9-20(10-6-18)29(32)33)16-23(30)28-14-11-22-21(12-15-34-22)24(28)17-3-7-19(26)8-4-17/h2-10,12,15,24H,1,11,13-14,16H2 |
| InChIKey | XUHUEONVZCSTHO-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|