C27H25FN2O2S — CID 3570713
N-[2-[4-(4-fluorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]-3-phenyl-N-prop-2-enylprop-2-enamide (PubChem CID 3570713) has the molecular formula C27H25FN2O2S and a molecular weight of 460.57 g/mol. Its IUPAC name is N-[2-[4-(4-fluorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]-3-phenyl-N-prop-2-enylprop-2-enamide.
| Compound Name | N-[2-[4-(4-fluorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]-3-phenyl-N-prop-2-enylprop-2-enamide |
|---|---|
| PubChem CID | 3570713 |
| Molecular Formula | C27H25FN2O2S |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | N-[2-[4-(4-fluorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]-3-phenyl-N-prop-2-enylprop-2-enamide |
| SMILES | C=CCN(CC(=O)N1CCc2sccc2C1c1ccc(F)cc1)C(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C27H25FN2O2S/c1-2-16-29(25(31)13-8-20-6-4-3-5-7-20)19-26(32)30-17-14-24-23(15-18-33-24)27(30)21-9-11-22(28)12-10-21/h2-13,15,18,27H,1,14,16-17,19H2 |
| InChIKey | ZDQLZMUKGPKFNL-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|