C10H24N2O2S — CID 61123366
N-[3-(aminomethyl)pentan-3-yl]butane-1-sulfonamide (PubChem CID 61123366) has the molecular formula C10H24N2O2S and a molecular weight of 236.38 g/mol. Its IUPAC name is N-[3-(aminomethyl)pentan-3-yl]butane-1-sulfonamide.
| Compound Name | N-[3-(aminomethyl)pentan-3-yl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 61123366 |
| Molecular Formula | C10H24N2O2S |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | N-[3-(aminomethyl)pentan-3-yl]butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)NC(CC)(CC)CN |
| InChI | InChI=1S/C10H24N2O2S/c1-4-7-8-15(13,14)12-10(5-2,6-3)9-11/h12H,4-9,11H2,1-3H3 |
| InChIKey | IJGZJIRLIBKVPE-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |