C12H11N3O2 — CID 61123534
2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)pentanenitrile (PubChem CID 61123534) has the molecular formula C12H11N3O2 and a molecular weight of 229.24 g/mol. Its IUPAC name is 2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)pentanenitrile.
| Compound Name | 2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)pentanenitrile |
|---|---|
| PubChem CID | 61123534 |
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)pentanenitrile |
| SMILES | CCCC(C#N)N1C(=O)c2cccnc2C1=O |
| InChI | InChI=1S/C12H11N3O2/c1-2-4-8(7-13)15-11(16)9-5-3-6-14-10(9)12(15)17/h3,5-6,8H,2,4H2,1H3 |
| InChIKey | MTVHGSJEMSTHTI-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 74.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|