C10H22N2O2S2 — CID 61123686
2-(butylsulfonylamino)-2-ethylbutanethioamide (PubChem CID 61123686) has the molecular formula C10H22N2O2S2 and a molecular weight of 266.43 g/mol. Its IUPAC name is 2-(butylsulfonylamino)-2-ethylbutanethioamide.
| Compound Name | 2-(butylsulfonylamino)-2-ethylbutanethioamide |
|---|---|
| PubChem CID | 61123686 |
| Molecular Formula | C10H22N2O2S2 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 2-(butylsulfonylamino)-2-ethylbutanethioamide |
| SMILES | CCCCS(=O)(=O)NC(CC)(CC)C(N)=S |
| InChI | InChI=1S/C10H22N2O2S2/c1-4-7-8-16(13,14)12-10(5-2,6-3)9(11)15/h12H,4-8H2,1-3H3,(H2,11,15) |
| InChIKey | KCXMZLXYFZYAJG-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|