C8H18N2O2S2 — CID 61123687
2-ethyl-2-(ethylsulfonylamino)butanethioamide (PubChem CID 61123687) has the molecular formula C8H18N2O2S2 and a molecular weight of 238.38 g/mol. Its IUPAC name is 2-ethyl-2-(ethylsulfonylamino)butanethioamide.
| Compound Name | 2-ethyl-2-(ethylsulfonylamino)butanethioamide |
|---|---|
| PubChem CID | 61123687 |
| Molecular Formula | C8H18N2O2S2 |
| Molecular Weight | 238.38 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 2-ethyl-2-(ethylsulfonylamino)butanethioamide |
| SMILES | CCC(CC)(NS(=O)(=O)CC)C(N)=S |
| InChI | InChI=1S/C8H18N2O2S2/c1-4-8(5-2,7(9)13)10-14(11,12)6-3/h10H,4-6H2,1-3H3,(H2,9,13) |
| InChIKey | QBWZIIJNYXLPHJ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.38 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|